What is the (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene?

(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is , while it's Molecular Formula is C10H20 O3. Used in Polymer Production: (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is used as a crosslinking agent for enhancing the structural integrity and properties of polymers. Its ability to form covalent bonds between polymer chains results in improved mechanical strength, thermal stability, and chemical resistance in the final product. Used in Chemical Reactions: As a solvent, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene plays a crucial role in various chemical reactions. Its wide solubility range allows it to dissolve a broad spectrum of substances, facilitating reaction kinetics and ensuring a homogeneous reaction environment. Used in Adhesives: (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is used as a component in the formulation of adhesives, where its crosslinking properties contribute to the development of strong and durable bonds between different materials. Used in Coatings: In the coatings industry, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is utilized to improve the adhesion, flexibility, and durability of coating materials, providing a robust and long-lasting protective layer on various surfaces. Used in Sealants: (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is also employed in the production of sealants, where its crosslinking ability helps create a tight, impermeable barrier that is resistant to environmental factors such as moisture, temperature fluctuations, and mechanical stress. Overall, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is a valuable chemical intermediate with a diverse range of applications across different industries, thanks to its unique structural features and functional properties.

What is the CAS number for (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene?

The CAS number of (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is 50876-87-4.

What is (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene (50876-87-4) used for?

(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene, with the molecular formula C10H20O3, is an unsaturated ether characterized by a six-carbon hydrocarbon chain and two ethylene glycol moieties. This chemical compound is known for its versatility in organic synthesis, facilitated by the presence of a double bond in the hexene group and the solubility-enhancing dimethoxyethoxy group, which also contributes to its stability under various reaction conditions.InChI:InChI=1/C10H20O3/c1-4-5-6-7-8-13-9-10(11-2)12-3/h5-6,10H,4,7-9H2,1-3H3/b6-5+

What is the (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene?

(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is , while it's Molecular Formula is C10H20 O3. Used in Polymer Production: (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is used as a crosslinking agent for enhancing the structural integrity and properties of polymers. Its ability to form covalent bonds between polymer chains results in improved mechanical strength, thermal stability, and chemical resistance in the final product. Used in Chemical Reactions: As a solvent, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene plays a crucial role in various chemical reactions. Its wide solubility range allows it to dissolve a broad spectrum of substances, facilitating reaction kinetics and ensuring a homogeneous reaction environment. Used in Adhesives: (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is used as a component in the formulation of adhesives, where its crosslinking properties contribute to the development of strong and durable bonds between different materials. Used in Coatings: In the coatings industry, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is utilized to improve the adhesion, flexibility, and durability of coating materials, providing a robust and long-lasting protective layer on various surfaces. Used in Sealants: (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is also employed in the production of sealants, where its crosslinking ability helps create a tight, impermeable barrier that is resistant to environmental factors such as moisture, temperature fluctuations, and mechanical stress. Overall, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is a valuable chemical intermediate with a diverse range of applications across different industries, thanks to its unique structural features and functional properties.

What is the CAS number for (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene?

The CAS number of (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is 50876-87-4.

What is (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene (50876-87-4) used for?

(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene, with the molecular formula C10H20O3, is an unsaturated ether characterized by a six-carbon hydrocarbon chain and two ethylene glycol moieties. This chemical compound is known for its versatility in organic synthesis, facilitated by the presence of a double bond in the hexene group and the solubility-enhancing dimethoxyethoxy group, which also contributes to its stability under various reaction conditions.InChI:InChI=1/C10H20O3/c1-4-5-6-7-8-13-9-10(11-2)12-3/h5-6,10H,4,7-9H2,1-3H3/b6-5+

Your Location:Home > Others > (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene

Product classification

(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene

Name: (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene
CAS: 50876-87-4
Purity: 99%

Inquiry

Details

Factory supply (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene 50876-87-4 with low price

Molecular Formula: C10H20 O3
Molecular Weight: 188.267
Vapor Pressure: 0.122mmHg at 25°C
Boiling Point: 226.6°Cat760mmHg
Flash Point: 80.1°C
PSA： 27.69000
Density: 0.91g/cm³
LogP: 1.97820

(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene(Cas 50876-87-4) Usage

General Description

(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is a chemical compound with the molecular formula C10H20O3. It is an unsaturated ether with a six-carbon hydrocarbon chain and two ethylene glycol moieties. (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is commonly used as a crosslinking agent in the production of polymers and as a solvent in chemical reactions. It has a variety of industrial applications, including as a component in adhesives, coatings, and sealants. The presence of the double bond in the hexene group provides potential for further chemical modifications and reactions, making it a versatile building block in organic synthesis. Additionally, its dimethoxyethoxy group contributes to its solubility in a wide range of solvents and its stability under various reaction conditions.

InChI:InChI=1/C10H20O3/c1-4-5-6-7-8-13-9-10(11-2)12-3/h5-6,10H,4,7-9H2,1-3H3/b6-5+

50876-87-4 Process route

: 50876-87-4
(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene

Conditions

Conditions	Yield
cis-Hexen-3-ol-1, 1) NaH, Mineraloeldisp., Isopropylether, Hexamethylphosphortriamid, 2) Bromacetaldehyd-dimethylacetal, reflux, nach Hydrolyse;

Home

About Us

Products

Pharmaceutical

Organic Chemicals

Agrochemicals

Others

News

Contact Us